C24H34IN3O5 — CID 111376287
1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111376287) has the molecular formula C24H34IN3O5 and a molecular weight of 571.46 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111376287 |
| Molecular Formula | C24H34IN3O5 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(OC)c(OC)c(OC)c1)NCC(C)(C)c1ccc2c(c1)OCCO2.I |
| InChI | InChI=1S/C24H33N3O5.HI/c1-24(2,17-7-8-18-19(13-17)32-10-9-31-18)15-27-23(25-3)26-14-16-11-20(28-4)22(30-6)21(12-16)29-5;/h7-8,11-13H,9-10,14-15H2,1-6H3,(H2,25,26,27);1H |
| InChIKey | RHEBHWHHUQHKNM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|