C19H32IN5O3 — CID 111378659
N-tert-butyl-2-[[N-butyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111378659) has the molecular formula C19H32IN5O3 and a molecular weight of 505.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-butyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-butyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111378659 |
| Molecular Formula | C19H32IN5O3 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-tert-butyl-2-[[N-butyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N(C)CC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C19H31N5O3.HI/c1-6-7-12-20-18(23(5)14-17(25)22-19(2,3)4)21-13-15-8-10-16(11-9-15)24(26)27;/h8-11H,6-7,12-14H2,1-5H3,(H,20,21)(H,22,25);1H |
| InChIKey | PTLWRNXWVUIYLJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|