C19H27IN4O4 — CID 111319703
3-(3-ethoxypropyl)-1-(furan-2-ylmethyl)-1-methyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111319703) has the molecular formula C19H27IN4O4 and a molecular weight of 502.35 g/mol. Its IUPAC name is 3-(3-ethoxypropyl)-1-(furan-2-ylmethyl)-1-methyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-(3-ethoxypropyl)-1-(furan-2-ylmethyl)-1-methyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111319703 |
| Molecular Formula | C19H27IN4O4 |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 3-(3-ethoxypropyl)-1-(furan-2-ylmethyl)-1-methyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N(C)Cc1ccco1.I |
| InChI | InChI=1S/C19H26N4O4.HI/c1-3-26-12-5-11-20-19(22(2)15-18-6-4-13-27-18)21-14-16-7-9-17(10-8-16)23(24)25;/h4,6-10,13H,3,5,11-12,14-15H2,1-2H3,(H,20,21);1H |
| InChIKey | AOFCVAMILYVPPM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|