C18H23IN4O3 — CID 111319715
1-(furan-2-ylmethyl)-1-methyl-3-(2-methylprop-2-enyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111319715) has the molecular formula C18H23IN4O3 and a molecular weight of 470.31 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-methyl-3-(2-methylprop-2-enyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(furan-2-ylmethyl)-1-methyl-3-(2-methylprop-2-enyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111319715 |
| Molecular Formula | C18H23IN4O3 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-methyl-3-(2-methylprop-2-enyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N(C)Cc1ccco1.I |
| InChI | InChI=1S/C18H22N4O3.HI/c1-14(2)11-19-18(21(3)13-17-5-4-10-25-17)20-12-15-6-8-16(9-7-15)22(23)24;/h4-10H,1,11-13H2,2-3H3,(H,19,20);1H |
| InChIKey | HCEIBHAZTHLTTJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|