C19H24FIN4O3 — CID 111541837
1-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-1-methyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111541837) has the molecular formula C19H24FIN4O3 and a molecular weight of 502.33 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-1-methyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-1-methyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111541837 |
| Molecular Formula | C19H24FIN4O3 |
| Molecular Weight | 502.33 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-(2-methoxyethyl)-1-methyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | COCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C19H23FN4O3.HI/c1-23(14-16-4-3-5-17(20)12-16)19(21-10-11-27-2)22-13-15-6-8-18(9-7-15)24(25)26;/h3-9,12H,10-11,13-14H2,1-2H3,(H,21,22);1H |
| InChIKey | MJCVRJBOIGQSNU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|