C19H31N5O4 — CID 110021278
N-tert-butyl-2-[[N-(3-methoxypropyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]-methylamino]acetamide (PubChem CID 110021278) has the molecular formula C19H31N5O4 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-(3-methoxypropyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]-methylamino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-(3-methoxypropyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 110021278 |
| Molecular Formula | C19H31N5O4 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N-tert-butyl-2-[[N-(3-methoxypropyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]-methylamino]acetamide |
| SMILES | COCCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N(C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H31N5O4/c1-19(2,3)22-17(25)14-23(4)18(20-11-6-12-28-5)21-13-15-7-9-16(10-8-15)24(26)27/h7-10H,6,11-14H2,1-5H3,(H,20,21)(H,22,25) |
| InChIKey | BGDDXDNGONTBQI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|