C21H27FIN5O4 — CID 110021147
2-[[N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110021147) has the molecular formula C21H27FIN5O4 and a molecular weight of 559.38 g/mol. Its IUPAC name is 2-[[N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110021147 |
| Molecular Formula | C21H27FIN5O4 |
| Molecular Weight | 559.38 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 2-[[N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(CN(C)/C(=N/Cc2ccc([N+](=O)[O-])cc2)NCC(=O)N(C)C)cc1F.I |
| InChI | InChI=1S/C21H26FN5O4.HI/c1-25(2)20(28)13-24-21(23-12-15-5-8-17(9-6-15)27(29)30)26(3)14-16-7-10-19(31-4)18(22)11-16;/h5-11H,12-14H2,1-4H3,(H,23,24);1H |
| InChIKey | ZDEUGDPYFWKPJE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|