C14H29N5O — CID 111384659
N-tert-butyl-2-[[N'-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111384659) has the molecular formula C14H29N5O and a molecular weight of 283.42 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111384659 |
| Molecular Formula | C14H29N5O |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC1CCCN1C |
| InChI | InChI=1S/C14H29N5O/c1-14(2,3)18-12(20)10-17-13(15-4)16-9-11-7-6-8-19(11)5/h11H,6-10H2,1-5H3,(H,18,20)(H2,15,16,17) |
| InChIKey | IHDLBWQIOBEQFL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|