C22H35IN6O3 — CID 111384742
N-tert-butyl-2-[[N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111384742) has the molecular formula C22H35IN6O3 and a molecular weight of 558.47 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111384742 |
| Molecular Formula | C22H35IN6O3 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | N-tert-butyl-2-[[N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCCCCc1nc(-c2ccc(OC)cc2)no1)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C22H34N6O3.HI/c1-22(2,3)27-18(29)15-25-21(23-4)24-14-8-6-7-9-19-26-20(28-31-19)16-10-12-17(30-5)13-11-16;/h10-13H,6-9,14-15H2,1-5H3,(H,27,29)(H2,23,24,25);1H |
| InChIKey | IRYQDZWHJIAOIL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|