C22H33N5O2S — CID 111390487
1-[3-(N-ethylanilino)propyl]-2-methyl-3-[[3-(methylsulfamoylmethyl)phenyl]methyl]guanidine (PubChem CID 111390487) has the molecular formula C22H33N5O2S and a molecular weight of 431.61 g/mol. Its IUPAC name is 1-[3-(N-ethylanilino)propyl]-2-methyl-3-[[3-(methylsulfamoylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[3-(N-ethylanilino)propyl]-2-methyl-3-[[3-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111390487 |
| Molecular Formula | C22H33N5O2S |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 1-[3-(N-ethylanilino)propyl]-2-methyl-3-[[3-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN(CCCN/C(=N\C)NCc1cccc(CS(=O)(=O)NC)c1)c1ccccc1 |
| InChI | InChI=1S/C22H33N5O2S/c1-4-27(21-12-6-5-7-13-21)15-9-14-25-22(23-2)26-17-19-10-8-11-20(16-19)18-30(28,29)24-3/h5-8,10-13,16,24H,4,9,14-15,17-18H2,1-3H3,(H2,23,25,26) |
| InChIKey | KILBYXCUUGDDLS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|