C13H28N4O3S — CID 111390577
2-[3-(cyclopropylmethoxy)propyl]-1-ethyl-3-[2-(methanesulfonamido)ethyl]guanidine (PubChem CID 111390577) has the molecular formula C13H28N4O3S and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-[3-(cyclopropylmethoxy)propyl]-1-ethyl-3-[2-(methanesulfonamido)ethyl]guanidine.
| Compound Name | 2-[3-(cyclopropylmethoxy)propyl]-1-ethyl-3-[2-(methanesulfonamido)ethyl]guanidine |
|---|---|
| PubChem CID | 111390577 |
| Molecular Formula | C13H28N4O3S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-[3-(cyclopropylmethoxy)propyl]-1-ethyl-3-[2-(methanesulfonamido)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC1CC1)NCCNS(C)(=O)=O |
| InChI | InChI=1S/C13H28N4O3S/c1-3-14-13(16-8-9-17-21(2,18)19)15-7-4-10-20-11-12-5-6-12/h12,17H,3-11H2,1-2H3,(H2,14,15,16) |
| InChIKey | YDRDWKHGYFIBGN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|