C11H18N2O2S — CID 11139304
(2R,3R,4S)-2-[(2-thiophen-2-ylethylamino)methyl]pyrrolidine-3,4-diol (PubChem CID 11139304) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is (2R,3R,4S)-2-[(2-thiophen-2-ylethylamino)methyl]pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4S)-2-[(2-thiophen-2-ylethylamino)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 11139304 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (2R,3R,4S)-2-[(2-thiophen-2-ylethylamino)methyl]pyrrolidine-3,4-diol |
| SMILES | O[C@H]1[C@@H](O)CN[C@@H]1CNCCc1cccs1 |
| InChI | InChI=1S/C11H18N2O2S/c14-10-7-13-9(11(10)15)6-12-4-3-8-2-1-5-16-8/h1-2,5,9-15H,3-4,6-7H2/t9-,10+,11-/m1/s1 |
| InChIKey | BNPBOKJPMAYPGZ-OUAUKWLOSA-N |
| XLogP | -0.43 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|