C18H25FN4S — CID 111395223
1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111395223) has the molecular formula C18H25FN4S and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111395223 |
| Molecular Formula | C18H25FN4S |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1cccc(F)c1)NCCc1csc(C(C)C)n1 |
| InChI | InChI=1S/C18H25FN4S/c1-13(2)17-23-16(12-24-17)8-10-22-18(20-3)21-9-7-14-5-4-6-15(19)11-14/h4-6,11-13H,7-10H2,1-3H3,(H2,20,21,22) |
| InChIKey | CWXVAPDGGMQFCA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|