C22H32FIN4 — CID 111395602
1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111395602) has the molecular formula C22H32FIN4 and a molecular weight of 498.43 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111395602 |
| Molecular Formula | C22H32FIN4 |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccc(F)c1)NCc1ccccc1CN(C)C(C)C.I |
| InChI | InChI=1S/C22H31FN4.HI/c1-17(2)27(4)16-20-10-6-5-9-19(20)15-26-22(24-3)25-13-12-18-8-7-11-21(23)14-18;/h5-11,14,17H,12-13,15-16H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | NIXTWNPWPOOEFC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|