C22H31FN4 — CID 111395603
1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine (PubChem CID 111395603) has the molecular formula C22H31FN4 and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111395603 |
| Molecular Formula | C22H31FN4 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCc1cccc(F)c1)NCc1ccccc1CN(C)C(C)C |
| InChI | InChI=1S/C22H31FN4/c1-17(2)27(4)16-20-10-6-5-9-19(20)15-26-22(24-3)25-13-12-18-8-7-11-21(23)14-18/h5-11,14,17H,12-13,15-16H2,1-4H3,(H2,24,25,26) |
| InChIKey | DBBNVVVQCQLQIJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|