C7H7F7O2 — CID 11139725
2-(2,2,3,3,4,4,4-heptafluorobutyl)-1,3-dioxolane (PubChem CID 11139725) has the molecular formula C7H7F7O2 and a molecular weight of 256.12 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutyl)-1,3-dioxolane.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 11139725 |
| Molecular Formula | C7H7F7O2 |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutyl)-1,3-dioxolane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)CC1OCCO1 |
| InChI | InChI=1S/C7H7F7O2/c8-5(9,3-4-15-1-2-16-4)6(10,11)7(12,13)14/h4H,1-3H2 |
| InChIKey | RBXFGBRZNHWPDH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|