C21H31N5O — CID 111397953
1-(3-cyclohexyloxypropyl)-2-methyl-3-[(1-phenylpyrazol-3-yl)methyl]guanidine (PubChem CID 111397953) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-(3-cyclohexyloxypropyl)-2-methyl-3-[(1-phenylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-(3-cyclohexyloxypropyl)-2-methyl-3-[(1-phenylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111397953 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 1-(3-cyclohexyloxypropyl)-2-methyl-3-[(1-phenylpyrazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCCCOC1CCCCC1)NCc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H31N5O/c1-22-21(23-14-8-16-27-20-11-6-3-7-12-20)24-17-18-13-15-26(25-18)19-9-4-2-5-10-19/h2,4-5,9-10,13,15,20H,3,6-8,11-12,14,16-17H2,1H3,(H2,22,23,24) |
| InChIKey | NNJNTLYUNSUFDO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|