C20H33N5O3 — CID 111398609
1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine (PubChem CID 111398609) has the molecular formula C20H33N5O3 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111398609 |
| Molecular Formula | C20H33N5O3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCCCOCc1ccco1 |
| InChI | InChI=1S/C20H33N5O3/c1-5-21-20(22-9-7-11-27-15-18-8-6-12-28-18)23-14-19-16(2)24-25(17(19)3)10-13-26-4/h6,8,12H,5,7,9-11,13-15H2,1-4H3,(H2,21,22,23) |
| InChIKey | UDWLSRKCSNAIFF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|