C20H32N6O2 — CID 111399327
1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine (PubChem CID 111399327) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111399327 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCOCc1ccco1)NCCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C20H32N6O2/c1-2-21-20(22-11-7-14-27-16-17-8-6-15-28-17)23-12-10-19-25-24-18-9-4-3-5-13-26(18)19/h6,8,15H,2-5,7,9-14,16H2,1H3,(H2,21,22,23) |
| InChIKey | NWKYOGUJTIRFAF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|