C19H26N4O3S — CID 111400163
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine (PubChem CID 111400163) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111400163 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCC(=O)N1CCc2sccc2C1 |
| InChI | InChI=1S/C19H26N4O3S/c1-20-19(21-7-3-9-25-14-16-4-2-10-26-16)22-12-18(24)23-8-5-17-15(13-23)6-11-27-17/h2,4,6,10-11H,3,5,7-9,12-14H2,1H3,(H2,20,21,22) |
| InChIKey | SNPCJQQCECVRRO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|