C21H32N6O2 — CID 111401211
N-[3-[[[N'-methyl-N-[3-(2-methylpropoxy)propyl]carbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide (PubChem CID 111401211) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[3-(2-methylpropoxy)propyl]carbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide.
| Compound Name | N-[3-[[[N'-methyl-N-[3-(2-methylpropoxy)propyl]carbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 111401211 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[3-(2-methylpropoxy)propyl]carbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
| SMILES | C/N=C(\NCCCOCC(C)C)NCc1cccc(NC(=O)Cn2cccn2)c1 |
| InChI | InChI=1S/C21H32N6O2/c1-17(2)16-29-12-6-9-23-21(22-3)24-14-18-7-4-8-19(13-18)26-20(28)15-27-11-5-10-25-27/h4-5,7-8,10-11,13,17H,6,9,12,14-16H2,1-3H3,(H,26,28)(H2,22,23,24) |
| InChIKey | PZMKJUZIEHMKKK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|