C23H34N6O — CID 111557859
N-[3-[[[N'-methyl-N-[2-(3-methylcyclohexyl)ethyl]carbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide (PubChem CID 111557859) has the molecular formula C23H34N6O and a molecular weight of 410.57 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[2-(3-methylcyclohexyl)ethyl]carbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide.
| Compound Name | N-[3-[[[N'-methyl-N-[2-(3-methylcyclohexyl)ethyl]carbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 111557859 |
| Molecular Formula | C23H34N6O |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[2-(3-methylcyclohexyl)ethyl]carbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
| SMILES | C/N=C(\NCCC1CCCC(C)C1)NCc1cccc(NC(=O)Cn2cccn2)c1 |
| InChI | InChI=1S/C23H34N6O/c1-18-6-3-7-19(14-18)10-12-25-23(24-2)26-16-20-8-4-9-21(15-20)28-22(30)17-29-13-5-11-27-29/h4-5,8-9,11,13,15,18-19H,3,6-7,10,12,14,16-17H2,1-2H3,(H,28,30)(H2,24,25,26) |
| InChIKey | PQKCORFKSOKUDG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|