C23H35N7O — CID 111324532
N-[3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide (PubChem CID 111324532) has the molecular formula C23H35N7O and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide.
| Compound Name | N-[3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 111324532 |
| Molecular Formula | C23H35N7O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | N-[3-[[[N-[3-(azepan-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
| SMILES | C/N=C(/NCCCN1CCCCCC1)NCc1cccc(NC(=O)Cn2cccn2)c1 |
| InChI | InChI=1S/C23H35N7O/c1-24-23(25-11-7-15-29-13-4-2-3-5-14-29)26-18-20-9-6-10-21(17-20)28-22(31)19-30-16-8-12-27-30/h6,8-10,12,16-17H,2-5,7,11,13-15,18-19H2,1H3,(H,28,31)(H2,24,25,26) |
| InChIKey | AVWLCJGVXOLERT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|