C15H18O3S — CID 11140423
[(Z)-2-methoxy-5,5-dimethylhex-1-en-3-ynyl]sulfonylbenzene (PubChem CID 11140423) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is [(Z)-2-methoxy-5,5-dimethylhex-1-en-3-ynyl]sulfonylbenzene.
| Compound Name | [(Z)-2-methoxy-5,5-dimethylhex-1-en-3-ynyl]sulfonylbenzene |
|---|---|
| PubChem CID | 11140423 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | [(Z)-2-methoxy-5,5-dimethylhex-1-en-3-ynyl]sulfonylbenzene |
| SMILES | CO/C(C#CC(C)(C)C)=C\S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O3S/c1-15(2,3)11-10-13(18-4)12-19(16,17)14-8-6-5-7-9-14/h5-9,12H,1-4H3/b13-12- |
| InChIKey | LLDCPPXGASYCFT-SEYXRHQNSA-N |
| XLogP | 3.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|