C16H20O3S — CID 177499106
[(E)-2-ethoxy-5,5-dimethylhex-1-en-3-ynyl]sulfonylbenzene (PubChem CID 177499106) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is [(E)-2-ethoxy-5,5-dimethylhex-1-en-3-ynyl]sulfonylbenzene.
| Compound Name | [(E)-2-ethoxy-5,5-dimethylhex-1-en-3-ynyl]sulfonylbenzene |
|---|---|
| PubChem CID | 177499106 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [(E)-2-ethoxy-5,5-dimethylhex-1-en-3-ynyl]sulfonylbenzene |
| SMILES | CCO/C(C#CC(C)(C)C)=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O3S/c1-5-19-14(11-12-16(2,3)4)13-20(17,18)15-9-7-6-8-10-15/h6-10,13H,5H2,1-4H3/b14-13+ |
| InChIKey | RCMPRDBADFYSAW-BUHFOSPRSA-N |
| XLogP | 3.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|