C16H18O5S — CID 11141815
(1R,2R,6R,7R)-4,4-dimethyl-11-phenylsulfanyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one (PubChem CID 11141815) has the molecular formula C16H18O5S and a molecular weight of 322.38 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4,4-dimethyl-11-phenylsulfanyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one.
| Compound Name | (1R,2R,6R,7R)-4,4-dimethyl-11-phenylsulfanyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one |
|---|---|
| PubChem CID | 11141815 |
| Molecular Formula | C16H18O5S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (1R,2R,6R,7R)-4,4-dimethyl-11-phenylsulfanyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1COC(=O)C(Sc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C16H18O5S/c1-16(2)20-11-10-8-18-15(17)14(13(19-10)12(11)21-16)22-9-6-4-3-5-7-9/h3-7,10-14H,8H2,1-2H3/t10-,11-,12-,13-,14?/m1/s1 |
| InChIKey | KDGREBMOACRKBF-GNMOMJPPSA-N |
| XLogP | 1.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |