C17H22N4O2S — CID 111424041
1-(2-hydroxyethyl)-3-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]-1-prop-2-enylurea (PubChem CID 111424041) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]-1-prop-2-enylurea.
| Compound Name | 1-(2-hydroxyethyl)-3-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 111424041 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]-1-prop-2-enylurea |
| SMILES | C=CCN(CCO)C(=O)Nc1nnc(C(CC)c2ccccc2)s1 |
| InChI | InChI=1S/C17H22N4O2S/c1-3-10-21(11-12-22)17(23)18-16-20-19-15(24-16)14(4-2)13-8-6-5-7-9-13/h3,5-9,14,22H,1,4,10-12H2,2H3,(H,18,20,23) |
| InChIKey | INZWBNOJIFOZDY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|