C9H12F2N4O2S — CID 111423985
3-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-1-(2-hydroxyethyl)-1-prop-2-enylurea (PubChem CID 111423985) has the molecular formula C9H12F2N4O2S and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-1-(2-hydroxyethyl)-1-prop-2-enylurea.
| Compound Name | 3-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-1-(2-hydroxyethyl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 111423985 |
| Molecular Formula | C9H12F2N4O2S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 3-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-1-(2-hydroxyethyl)-1-prop-2-enylurea |
| SMILES | C=CCN(CCO)C(=O)Nc1nnc(C(F)F)s1 |
| InChI | InChI=1S/C9H12F2N4O2S/c1-2-3-15(4-5-16)9(17)12-8-14-13-7(18-8)6(10)11/h2,6,16H,1,3-5H2,(H,12,14,17) |
| InChIKey | LBQLTKPNUHJPKO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|