C16H31NO3 — CID 111424785
1-(oxolan-2-ylmethoxy)-3-(2-propan-2-ylpiperidin-1-yl)propan-2-ol (PubChem CID 111424785) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethoxy)-3-(2-propan-2-ylpiperidin-1-yl)propan-2-ol.
| Compound Name | 1-(oxolan-2-ylmethoxy)-3-(2-propan-2-ylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 111424785 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 1-(oxolan-2-ylmethoxy)-3-(2-propan-2-ylpiperidin-1-yl)propan-2-ol |
| SMILES | CC(C)C1CCCCN1CC(O)COCC1CCCO1 |
| InChI | InChI=1S/C16H31NO3/c1-13(2)16-7-3-4-8-17(16)10-14(18)11-19-12-15-6-5-9-20-15/h13-16,18H,3-12H2,1-2H3 |
| InChIKey | YJMOLYFRNVVBJZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |