C17H27NO3S — CID 111336725
1-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]-3-(oxolan-2-ylmethoxy)propan-2-ol (PubChem CID 111336725) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is 1-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]-3-(oxolan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]-3-(oxolan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 111336725 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]-3-(oxolan-2-ylmethoxy)propan-2-ol |
| SMILES | Cc1ccc(C2CCCN2CC(O)COCC2CCCO2)s1 |
| InChI | InChI=1S/C17H27NO3S/c1-13-6-7-17(22-13)16-5-2-8-18(16)10-14(19)11-20-12-15-4-3-9-21-15/h6-7,14-16,19H,2-5,8-12H2,1H3 |
| InChIKey | CTVFQLWWIDKQCD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |