C18H26ClNO3 — CID 52539359
(2S)-1-[(2S)-2-(2-chlorophenyl)pyrrolidin-1-yl]-3-[[(2S)-oxolan-2-yl]methoxy]propan-2-ol (PubChem CID 52539359) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-(2-chlorophenyl)pyrrolidin-1-yl]-3-[[(2S)-oxolan-2-yl]methoxy]propan-2-ol.
| Compound Name | (2S)-1-[(2S)-2-(2-chlorophenyl)pyrrolidin-1-yl]-3-[[(2S)-oxolan-2-yl]methoxy]propan-2-ol |
|---|---|
| PubChem CID | 52539359 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (2S)-1-[(2S)-2-(2-chlorophenyl)pyrrolidin-1-yl]-3-[[(2S)-oxolan-2-yl]methoxy]propan-2-ol |
| SMILES | O[C@H](COC[C@@H]1CCCO1)CN1CCC[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C18H26ClNO3/c19-17-7-2-1-6-16(17)18-8-3-9-20(18)11-14(21)12-22-13-15-5-4-10-23-15/h1-2,6-7,14-15,18,21H,3-5,8-13H2/t14-,15-,18-/m0/s1 |
| InChIKey | IKOKFULIVUNATN-MPGHIAIKSA-N |
| XLogP | 3.03 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |