C16H26N2O3 — CID 111428404
1-(2-hydroxy-3,3-dimethylbutyl)-3-[3-(4-hydroxyphenyl)propyl]urea (PubChem CID 111428404) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-(2-hydroxy-3,3-dimethylbutyl)-3-[3-(4-hydroxyphenyl)propyl]urea.
| Compound Name | 1-(2-hydroxy-3,3-dimethylbutyl)-3-[3-(4-hydroxyphenyl)propyl]urea |
|---|---|
| PubChem CID | 111428404 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-(2-hydroxy-3,3-dimethylbutyl)-3-[3-(4-hydroxyphenyl)propyl]urea |
| SMILES | CC(C)(C)C(O)CNC(=O)NCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C16H26N2O3/c1-16(2,3)14(20)11-18-15(21)17-10-4-5-12-6-8-13(19)9-7-12/h6-9,14,19-20H,4-5,10-11H2,1-3H3,(H2,17,18,21) |
| InChIKey | WDQKKAHBVIJSRN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|