C18H27N3O2S — CID 145230148
1-[3-(4-hydroxyphenyl)propyl]-3-(2-thiophen-3-ylethyl)urea;N-methylmethanamine (PubChem CID 145230148) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-[3-(4-hydroxyphenyl)propyl]-3-(2-thiophen-3-ylethyl)urea;N-methylmethanamine.
| Compound Name | 1-[3-(4-hydroxyphenyl)propyl]-3-(2-thiophen-3-ylethyl)urea;N-methylmethanamine |
|---|---|
| PubChem CID | 145230148 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-[3-(4-hydroxyphenyl)propyl]-3-(2-thiophen-3-ylethyl)urea;N-methylmethanamine |
| SMILES | CNC.O=C(NCCCc1ccc(O)cc1)NCCc1ccsc1 |
| InChI | InChI=1S/C16H20N2O2S.C2H7N/c19-15-5-3-13(4-6-15)2-1-9-17-16(20)18-10-7-14-8-11-21-12-14;1-3-2/h3-6,8,11-12,19H,1-2,7,9-10H2,(H2,17,18,20);3H,1-2H3 |
| InChIKey | UDCQJCCMMONHFQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|