C20H25FN2O2 — CID 86973255
1-[2-(2-fluorophenyl)-2-methylpropyl]-3-[3-(4-hydroxyphenyl)propyl]urea (PubChem CID 86973255) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-2-methylpropyl]-3-[3-(4-hydroxyphenyl)propyl]urea.
| Compound Name | 1-[2-(2-fluorophenyl)-2-methylpropyl]-3-[3-(4-hydroxyphenyl)propyl]urea |
|---|---|
| PubChem CID | 86973255 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-2-methylpropyl]-3-[3-(4-hydroxyphenyl)propyl]urea |
| SMILES | CC(C)(CNC(=O)NCCCc1ccc(O)cc1)c1ccccc1F |
| InChI | InChI=1S/C20H25FN2O2/c1-20(2,17-7-3-4-8-18(17)21)14-23-19(25)22-13-5-6-15-9-11-16(24)12-10-15/h3-4,7-12,24H,5-6,13-14H2,1-2H3,(H2,22,23,25) |
| InChIKey | PKVHWUVNHQYEQS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|