C18H24FN3O3 — CID 56781513
1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]urea (PubChem CID 56781513) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]urea.
| Compound Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]urea |
|---|---|
| PubChem CID | 56781513 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]urea |
| SMILES | CC(C)(CNC(=O)NCCCN1C(=O)CCC1=O)c1ccccc1F |
| InChI | InChI=1S/C18H24FN3O3/c1-18(2,13-6-3-4-7-14(13)19)12-21-17(25)20-10-5-11-22-15(23)8-9-16(22)24/h3-4,6-7H,5,8-12H2,1-2H3,(H2,20,21,25) |
| InChIKey | WCEOGEHTQFLMEK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|