C14H21BrN2O2 — CID 111431387
1-(4-bromo-2,6-dimethylphenyl)-3-(2-hydroxypentyl)urea (PubChem CID 111431387) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)-3-(2-hydroxypentyl)urea.
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)-3-(2-hydroxypentyl)urea |
|---|---|
| PubChem CID | 111431387 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)-3-(2-hydroxypentyl)urea |
| SMILES | CCCC(O)CNC(=O)Nc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C14H21BrN2O2/c1-4-5-12(18)8-16-14(19)17-13-9(2)6-11(15)7-10(13)3/h6-7,12,18H,4-5,8H2,1-3H3,(H2,16,17,19) |
| InChIKey | XUJJEDDYAYOAQK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |