C15H17BrN2O2 — CID 71937795
1-(4-bromo-2,6-dimethylphenyl)-3-[(2-methylfuran-3-yl)methyl]urea (PubChem CID 71937795) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)-3-[(2-methylfuran-3-yl)methyl]urea.
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)-3-[(2-methylfuran-3-yl)methyl]urea |
|---|---|
| PubChem CID | 71937795 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)-3-[(2-methylfuran-3-yl)methyl]urea |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)NCc1ccoc1C |
| InChI | InChI=1S/C15H17BrN2O2/c1-9-6-13(16)7-10(2)14(9)18-15(19)17-8-12-4-5-20-11(12)3/h4-7H,8H2,1-3H3,(H2,17,18,19) |
| InChIKey | RCQUFYZKLFMYQI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |