C19H26N2O3 — CID 111432990
N-[4-[2-(1-hydroxybutan-2-ylamino)-2-oxoethyl]phenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 111432990) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[4-[2-(1-hydroxybutan-2-ylamino)-2-oxoethyl]phenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[4-[2-(1-hydroxybutan-2-ylamino)-2-oxoethyl]phenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 111432990 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[4-[2-(1-hydroxybutan-2-ylamino)-2-oxoethyl]phenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CCC(CO)NC(=O)Cc1ccc(NC(=O)C2CC=CCC2)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-2-16(13-22)20-18(23)12-14-8-10-17(11-9-14)21-19(24)15-6-4-3-5-7-15/h3-4,8-11,15-16,22H,2,5-7,12-13H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | FAMRFYJLZIOQRZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|