C17H26N2O2S — CID 111433504
2-(cyclohexylmethylsulfanyl)-N-(3-hydroxybutyl)pyridine-3-carboxamide (PubChem CID 111433504) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 2-(cyclohexylmethylsulfanyl)-N-(3-hydroxybutyl)pyridine-3-carboxamide.
| Compound Name | 2-(cyclohexylmethylsulfanyl)-N-(3-hydroxybutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 111433504 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(cyclohexylmethylsulfanyl)-N-(3-hydroxybutyl)pyridine-3-carboxamide |
| SMILES | CC(O)CCNC(=O)c1cccnc1SCC1CCCCC1 |
| InChI | InChI=1S/C17H26N2O2S/c1-13(20)9-11-18-16(21)15-8-5-10-19-17(15)22-12-14-6-3-2-4-7-14/h5,8,10,13-14,20H,2-4,6-7,9,11-12H2,1H3,(H,18,21) |
| InChIKey | SRQFJHUFYKQHRZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |