C18H20F2N2O2 — CID 111434565
4-[(3,4-difluorophenyl)methylamino]-N-(1-hydroxybutan-2-yl)benzamide (PubChem CID 111434565) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methylamino]-N-(1-hydroxybutan-2-yl)benzamide.
| Compound Name | 4-[(3,4-difluorophenyl)methylamino]-N-(1-hydroxybutan-2-yl)benzamide |
|---|---|
| PubChem CID | 111434565 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methylamino]-N-(1-hydroxybutan-2-yl)benzamide |
| SMILES | CCC(CO)NC(=O)c1ccc(NCc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H20F2N2O2/c1-2-14(11-23)22-18(24)13-4-6-15(7-5-13)21-10-12-3-8-16(19)17(20)9-12/h3-9,14,21,23H,2,10-11H2,1H3,(H,22,24) |
| InChIKey | QYPJEQMXSAUKDM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |