C14H21BrN2O3 — CID 111436409
N-(3-bromophenyl)-3-[2-hydroxyethyl(2-methoxyethyl)amino]propanamide (PubChem CID 111436409) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is N-(3-bromophenyl)-3-[2-hydroxyethyl(2-methoxyethyl)amino]propanamide.
| Compound Name | N-(3-bromophenyl)-3-[2-hydroxyethyl(2-methoxyethyl)amino]propanamide |
|---|---|
| PubChem CID | 111436409 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-(3-bromophenyl)-3-[2-hydroxyethyl(2-methoxyethyl)amino]propanamide |
| SMILES | COCCN(CCO)CCC(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C14H21BrN2O3/c1-20-10-8-17(7-9-18)6-5-14(19)16-13-4-2-3-12(15)11-13/h2-4,11,18H,5-10H2,1H3,(H,16,19) |
| InChIKey | PHVQSAYVHHAFQI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |