C12H20N2OS2 — CID 111436720
4-[[(2-ethyl-1,3-thiazol-4-yl)methylamino]methyl]thian-4-ol (PubChem CID 111436720) has the molecular formula C12H20N2OS2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 4-[[(2-ethyl-1,3-thiazol-4-yl)methylamino]methyl]thian-4-ol.
| Compound Name | 4-[[(2-ethyl-1,3-thiazol-4-yl)methylamino]methyl]thian-4-ol |
|---|---|
| PubChem CID | 111436720 |
| Molecular Formula | C12H20N2OS2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-[[(2-ethyl-1,3-thiazol-4-yl)methylamino]methyl]thian-4-ol |
| SMILES | CCc1nc(CNCC2(O)CCSCC2)cs1 |
| InChI | InChI=1S/C12H20N2OS2/c1-2-11-14-10(8-17-11)7-13-9-12(15)3-5-16-6-4-12/h8,13,15H,2-7,9H2,1H3 |
| InChIKey | BLMJVASEWDQJDF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |