C16H20N2OS2 — CID 111436762
4-[[(2-phenyl-1,3-thiazol-4-yl)methylamino]methyl]thian-4-ol (PubChem CID 111436762) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 4-[[(2-phenyl-1,3-thiazol-4-yl)methylamino]methyl]thian-4-ol.
| Compound Name | 4-[[(2-phenyl-1,3-thiazol-4-yl)methylamino]methyl]thian-4-ol |
|---|---|
| PubChem CID | 111436762 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 4-[[(2-phenyl-1,3-thiazol-4-yl)methylamino]methyl]thian-4-ol |
| SMILES | OC1(CNCc2csc(-c3ccccc3)n2)CCSCC1 |
| InChI | InChI=1S/C16H20N2OS2/c19-16(6-8-20-9-7-16)12-17-10-14-11-21-15(18-14)13-4-2-1-3-5-13/h1-5,11,17,19H,6-10,12H2 |
| InChIKey | GKQUUPFFCPPFQC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |