C12H19NOS2 — CID 115641770
4-[[(3-methylthiophen-2-yl)methylamino]methyl]thian-4-ol (PubChem CID 115641770) has the molecular formula C12H19NOS2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 4-[[(3-methylthiophen-2-yl)methylamino]methyl]thian-4-ol.
| Compound Name | 4-[[(3-methylthiophen-2-yl)methylamino]methyl]thian-4-ol |
|---|---|
| PubChem CID | 115641770 |
| Molecular Formula | C12H19NOS2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-[[(3-methylthiophen-2-yl)methylamino]methyl]thian-4-ol |
| SMILES | Cc1ccsc1CNCC1(O)CCSCC1 |
| InChI | InChI=1S/C12H19NOS2/c1-10-2-5-16-11(10)8-13-9-12(14)3-6-15-7-4-12/h2,5,13-14H,3-4,6-9H2,1H3 |
| InChIKey | BEIXKUFMQOPNIX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |