C13H19NO2S — CID 115247320
methyl 1-[[(3-methylthiophen-2-yl)methylamino]methyl]cyclobutane-1-carboxylate (PubChem CID 115247320) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is methyl 1-[[(3-methylthiophen-2-yl)methylamino]methyl]cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[[(3-methylthiophen-2-yl)methylamino]methyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 115247320 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | methyl 1-[[(3-methylthiophen-2-yl)methylamino]methyl]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(CNCc2sccc2C)CCC1 |
| InChI | InChI=1S/C13H19NO2S/c1-10-4-7-17-11(10)8-14-9-13(5-3-6-13)12(15)16-2/h4,7,14H,3,5-6,8-9H2,1-2H3 |
| InChIKey | UXXXUKAKJNPEIY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |