C16H23FN2O3 — CID 111438037
1-[4-(4-fluorophenoxy)butyl]-3-[(1-hydroxycyclobutyl)methyl]urea (PubChem CID 111438037) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is 1-[4-(4-fluorophenoxy)butyl]-3-[(1-hydroxycyclobutyl)methyl]urea.
| Compound Name | 1-[4-(4-fluorophenoxy)butyl]-3-[(1-hydroxycyclobutyl)methyl]urea |
|---|---|
| PubChem CID | 111438037 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[4-(4-fluorophenoxy)butyl]-3-[(1-hydroxycyclobutyl)methyl]urea |
| SMILES | O=C(NCCCCOc1ccc(F)cc1)NCC1(O)CCC1 |
| InChI | InChI=1S/C16H23FN2O3/c17-13-4-6-14(7-5-13)22-11-2-1-10-18-15(20)19-12-16(21)8-3-9-16/h4-7,21H,1-3,8-12H2,(H2,18,19,20) |
| InChIKey | OVZFVFQCDLIUJN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|