C14H22N2O3S — CID 111439582
N-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]thiophene-3-carboxamide (PubChem CID 111439582) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 111439582 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]thiophene-3-carboxamide |
| SMILES | O=C(NC1CCN(CCOCCO)CC1)c1ccsc1 |
| InChI | InChI=1S/C14H22N2O3S/c17-7-9-19-8-6-16-4-1-13(2-5-16)15-14(18)12-3-10-20-11-12/h3,10-11,13,17H,1-2,4-9H2,(H,15,18) |
| InChIKey | SQNJCMSJWFBCKT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|