About N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide
N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide (PubChem CID 131960395) has the molecular formula C18H28N4O3S
and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide |
| PubChem CID | 131960395 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)NCCN2CCCOCC2)CC1)c1ccsc1 |
| InChI | InChI=1S/C18H28N4O3S/c23-17(15-4-13-26-14-15)20-16-2-7-22(8-3-16)18(24)19-5-9-21-6-1-11-25-12-10-21/h4,13-14,16H,1-3,5-12H2,(H,19,24)(H,20,23) |
| InChIKey | RJYFIZAERKRMBJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide?
The IUPAC name of N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide (CID 131960395) is N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide.
What is the SMILES notation for N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide?
The canonical SMILES for N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide is O=C(NC1CCN(C(=O)NCCN2CCCOCC2)CC1)c1ccsc1.
What is the InChIKey of N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide?
The InChIKey is RJYFIZAERKRMBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4O3S/c23-17(15-4-13-26-14-15)20-16-2-7-22(8-3-16)18(24)19-5-9-21-6-1-11-25-12-10-21/h4,13-14,16H,1-3,5-12H2,(H,19,24)(H,20,23).
What are the key properties of N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide?
N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide has a molecular weight of 380.51 g/mol, XLogP of 1.37, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,4-oxazepan-4-yl)ethyl]-4-(thiophene-3-carbonylamino)piperidine-1-carboxamide is sourced from PubChem (CID 131960395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).