C13H15ClN2O2S2 — CID 111440861
1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylethyl)urea (PubChem CID 111440861) has the molecular formula C13H15ClN2O2S2 and a molecular weight of 330.86 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylethyl)urea.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylethyl)urea |
|---|---|
| PubChem CID | 111440861 |
| Molecular Formula | C13H15ClN2O2S2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylethyl)urea |
| SMILES | CC(NC(=O)NCC(O)c1ccsc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H15ClN2O2S2/c1-8(11-2-3-12(14)20-11)16-13(18)15-6-10(17)9-4-5-19-7-9/h2-5,7-8,10,17H,6H2,1H3,(H2,15,16,18) |
| InChIKey | OSBCLMATRSOKOH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |