C18H30N2O3 — CID 111442515
1-(2,6-dimethylmorpholin-4-yl)-3-(4-ethoxy-N-methylanilino)propan-2-ol (PubChem CID 111442515) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-(2,6-dimethylmorpholin-4-yl)-3-(4-ethoxy-N-methylanilino)propan-2-ol.
| Compound Name | 1-(2,6-dimethylmorpholin-4-yl)-3-(4-ethoxy-N-methylanilino)propan-2-ol |
|---|---|
| PubChem CID | 111442515 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-(2,6-dimethylmorpholin-4-yl)-3-(4-ethoxy-N-methylanilino)propan-2-ol |
| SMILES | CCOc1ccc(N(C)CC(O)CN2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C18H30N2O3/c1-5-22-18-8-6-16(7-9-18)19(4)12-17(21)13-20-10-14(2)23-15(3)11-20/h6-9,14-15,17,21H,5,10-13H2,1-4H3 |
| InChIKey | HZCJWMKDMKMBLX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|